C23H23FN4O3S — CID 41345110
N-[2-(diethylamino)ethyl]-2-(1,3-dioxoisoindol-2-yl)-N-(6-fluoro-1,3-benzothiazol-2-yl)acetamide (PubChem CID 41345110) has the molecular formula C23H23FN4O3S and a molecular weight of 454.53 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-2-(1,3-dioxoisoindol-2-yl)-N-(6-fluoro-1,3-benzothiazol-2-yl)acetamide.
| Compound Name | N-[2-(diethylamino)ethyl]-2-(1,3-dioxoisoindol-2-yl)-N-(6-fluoro-1,3-benzothiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 41345110 |
| Molecular Formula | C23H23FN4O3S |
| Molecular Weight | 454.53 g/mol |
| Exact Mass | 454.15 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-2-(1,3-dioxoisoindol-2-yl)-N-(6-fluoro-1,3-benzothiazol-2-yl)acetamide |
| SMILES | CCN(CC)CCN(C(=O)CN1C(=O)c2ccccc2C1=O)c1nc2ccc(F)cc2s1 |
| InChI | InChI=1S/C23H23FN4O3S/c1-3-26(4-2)11-12-27(23-25-18-10-9-15(24)13-19(18)32-23)20(29)14-28-21(30)16-7-5-6-8-17(16)22(28)31/h5-10,13H,3-4,11-12,14H2,1-2H3 |
| InChIKey | FNSYOFMWWTXRBX-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.53 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|