C22H17N5O3S — CID 30460060
N-(1,3-benzothiazol-2-yl)-2-(1,3-dioxoisoindol-2-yl)-N-(2-pyrazol-1-ylethyl)acetamide (PubChem CID 30460060) has the molecular formula C22H17N5O3S and a molecular weight of 431.48 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-(1,3-dioxoisoindol-2-yl)-N-(2-pyrazol-1-ylethyl)acetamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-(1,3-dioxoisoindol-2-yl)-N-(2-pyrazol-1-ylethyl)acetamide |
|---|---|
| PubChem CID | 30460060 |
| Molecular Formula | C22H17N5O3S |
| Molecular Weight | 431.48 g/mol |
| Exact Mass | 431.11 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-(1,3-dioxoisoindol-2-yl)-N-(2-pyrazol-1-ylethyl)acetamide |
| SMILES | O=C1c2ccccc2C(=O)N1CC(=O)N(CCn1cccn1)c1nc2ccccc2s1 |
| InChI | InChI=1S/C22H17N5O3S/c28-19(14-27-20(29)15-6-1-2-7-16(15)21(27)30)26(13-12-25-11-5-10-23-25)22-24-17-8-3-4-9-18(17)31-22/h1-11H,12-14H2 |
| InChIKey | FYASBVXSWQMTEC-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 88.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.48 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|