C20H15FIN3OS — CID 41348878
6-(4-fluorophenyl)-N-[(4-iodophenyl)methyl]-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide (PubChem CID 41348878) has the molecular formula C20H15FIN3OS and a molecular weight of 491.33 g/mol. Its IUPAC name is 6-(4-fluorophenyl)-N-[(4-iodophenyl)methyl]-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide.
| Compound Name | 6-(4-fluorophenyl)-N-[(4-iodophenyl)methyl]-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide |
|---|---|
| PubChem CID | 41348878 |
| Molecular Formula | C20H15FIN3OS |
| Molecular Weight | 491.33 g/mol |
| Exact Mass | 491.00 |
| IUPAC Name | 6-(4-fluorophenyl)-N-[(4-iodophenyl)methyl]-3-methylimidazo[2,1-b][1,3]thiazole-2-carboxamide |
| SMILES | Cc1c(C(=O)NCc2ccc(I)cc2)sc2nc(-c3ccc(F)cc3)cn12 |
| InChI | InChI=1S/C20H15FIN3OS/c1-12-18(19(26)23-10-13-2-8-16(22)9-3-13)27-20-24-17(11-25(12)20)14-4-6-15(21)7-5-14/h2-9,11H,10H2,1H3,(H,23,26) |
| InChIKey | GQCXYGQBFBCWSQ-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 46.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.33 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|