C20H18N2O3 — CID 41352483
[2-oxo-2-(quinolin-5-ylamino)ethyl] 3,5-dimethylbenzoate (PubChem CID 41352483) has the molecular formula C20H18N2O3 and a molecular weight of 334.38 g/mol. Its IUPAC name is [2-oxo-2-(quinolin-5-ylamino)ethyl] 3,5-dimethylbenzoate.
| Compound Name | [2-oxo-2-(quinolin-5-ylamino)ethyl] 3,5-dimethylbenzoate |
|---|---|
| PubChem CID | 41352483 |
| Molecular Formula | C20H18N2O3 |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.13 |
| IUPAC Name | [2-oxo-2-(quinolin-5-ylamino)ethyl] 3,5-dimethylbenzoate |
| SMILES | Cc1cc(C)cc(C(=O)OCC(=O)Nc2cccc3ncccc23)c1 |
| InChI | InChI=1S/C20H18N2O3/c1-13-9-14(2)11-15(10-13)20(24)25-12-19(23)22-18-7-3-6-17-16(18)5-4-8-21-17/h3-11H,12H2,1-2H3,(H,22,23) |
| InChIKey | GPSPQBXVUDUJJN-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |