C19H16N2O4 — CID 41332969
[2-oxo-2-(quinolin-5-ylamino)ethyl] 4-methoxybenzoate (PubChem CID 41332969) has the molecular formula C19H16N2O4 and a molecular weight of 336.35 g/mol. Its IUPAC name is [2-oxo-2-(quinolin-5-ylamino)ethyl] 4-methoxybenzoate.
| Compound Name | [2-oxo-2-(quinolin-5-ylamino)ethyl] 4-methoxybenzoate |
|---|---|
| PubChem CID | 41332969 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | [2-oxo-2-(quinolin-5-ylamino)ethyl] 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)OCC(=O)Nc2cccc3ncccc23)cc1 |
| InChI | InChI=1S/C19H16N2O4/c1-24-14-9-7-13(8-10-14)19(23)25-12-18(22)21-17-6-2-5-16-15(17)4-3-11-20-16/h2-11H,12H2,1H3,(H,21,22) |
| InChIKey | LNILLYOLQQODCX-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |