C20H27N3O4S2 — CID 41362332
[4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-1,4-diazepan-1-yl]-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)methanone (PubChem CID 41362332) has the molecular formula C20H27N3O4S2 and a molecular weight of 437.59 g/mol. Its IUPAC name is [4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-1,4-diazepan-1-yl]-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)methanone.
| Compound Name | [4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-1,4-diazepan-1-yl]-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)methanone |
|---|---|
| PubChem CID | 41362332 |
| Molecular Formula | C20H27N3O4S2 |
| Molecular Weight | 437.59 g/mol |
| Exact Mass | 437.14 |
| IUPAC Name | [4-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-1,4-diazepan-1-yl]-(5,6,7,8-tetrahydro-4H-cyclohepta[b]thiophen-2-yl)methanone |
| SMILES | Cc1noc(C)c1S(=O)(=O)N1CCCN(C(=O)c2cc3c(s2)CCCCC3)CC1 |
| InChI | InChI=1S/C20H27N3O4S2/c1-14-19(15(2)27-21-14)29(25,26)23-10-6-9-22(11-12-23)20(24)18-13-16-7-4-3-5-8-17(16)28-18/h13H,3-12H2,1-2H3 |
| InChIKey | LPODIRXHXCQISC-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 83.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.59 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |