C22H19FN4O3S — CID 4137759
ethyl 2-[[4-(4-fluorophenyl)-5-(1H-indol-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-3-oxobutanoate (PubChem CID 4137759) has the molecular formula C22H19FN4O3S and a molecular weight of 438.48 g/mol. Its IUPAC name is ethyl 2-[[4-(4-fluorophenyl)-5-(1H-indol-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-3-oxobutanoate.
| Compound Name | ethyl 2-[[4-(4-fluorophenyl)-5-(1H-indol-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-3-oxobutanoate |
|---|---|
| PubChem CID | 4137759 |
| Molecular Formula | C22H19FN4O3S |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | ethyl 2-[[4-(4-fluorophenyl)-5-(1H-indol-3-yl)-1,2,4-triazol-3-yl]sulfanyl]-3-oxobutanoate |
| SMILES | CCOC(=O)C(Sc1nnc(-c2c[nH]c3ccccc23)n1-c1ccc(F)cc1)C(C)=O |
| InChI | InChI=1S/C22H19FN4O3S/c1-3-30-21(29)19(13(2)28)31-22-26-25-20(27(22)15-10-8-14(23)9-11-15)17-12-24-18-7-5-4-6-16(17)18/h4-12,19,24H,3H2,1-2H3 |
| InChIKey | ZUTNCWHRCUFIEP-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|