C25H26N4O6S — CID 4253347
diethyl 2-[[4-(2,5-dimethoxyphenyl)-5-(1H-indol-3-yl)-1,2,4-triazol-3-yl]sulfanyl]propanedioate (PubChem CID 4253347) has the molecular formula C25H26N4O6S and a molecular weight of 510.57 g/mol. Its IUPAC name is diethyl 2-[[4-(2,5-dimethoxyphenyl)-5-(1H-indol-3-yl)-1,2,4-triazol-3-yl]sulfanyl]propanedioate.
| Compound Name | diethyl 2-[[4-(2,5-dimethoxyphenyl)-5-(1H-indol-3-yl)-1,2,4-triazol-3-yl]sulfanyl]propanedioate |
|---|---|
| PubChem CID | 4253347 |
| Molecular Formula | C25H26N4O6S |
| Molecular Weight | 510.57 g/mol |
| Exact Mass | 510.16 |
| IUPAC Name | diethyl 2-[[4-(2,5-dimethoxyphenyl)-5-(1H-indol-3-yl)-1,2,4-triazol-3-yl]sulfanyl]propanedioate |
| SMILES | CCOC(=O)C(Sc1nnc(-c2c[nH]c3ccccc23)n1-c1cc(OC)ccc1OC)C(=O)OCC |
| InChI | InChI=1S/C25H26N4O6S/c1-5-34-23(30)21(24(31)35-6-2)36-25-28-27-22(17-14-26-18-10-8-7-9-16(17)18)29(25)19-13-15(32-3)11-12-20(19)33-4/h7-14,21,26H,5-6H2,1-4H3 |
| InChIKey | CTKARFNXXUMQGX-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 117.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.57 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|