C20H22ClNO4 — CID 41386334
(2S)-2-(4-chlorophenoxy)-N-[2-[[(2R)-oxolan-2-yl]methoxy]phenyl]propanamide (PubChem CID 41386334) has the molecular formula C20H22ClNO4 and a molecular weight of 375.85 g/mol. Its IUPAC name is (2S)-2-(4-chlorophenoxy)-N-[2-[[(2R)-oxolan-2-yl]methoxy]phenyl]propanamide.
| Compound Name | (2S)-2-(4-chlorophenoxy)-N-[2-[[(2R)-oxolan-2-yl]methoxy]phenyl]propanamide |
|---|---|
| PubChem CID | 41386334 |
| Molecular Formula | C20H22ClNO4 |
| Molecular Weight | 375.85 g/mol |
| Exact Mass | 375.12 |
| IUPAC Name | (2S)-2-(4-chlorophenoxy)-N-[2-[[(2R)-oxolan-2-yl]methoxy]phenyl]propanamide |
| SMILES | C[C@H](Oc1ccc(Cl)cc1)C(=O)Nc1ccccc1OC[C@H]1CCCO1 |
| InChI | InChI=1S/C20H22ClNO4/c1-14(26-16-10-8-15(21)9-11-16)20(23)22-18-6-2-3-7-19(18)25-13-17-5-4-12-24-17/h2-3,6-11,14,17H,4-5,12-13H2,1H3,(H,22,23)/t14-,17+/m0/s1 |
| InChIKey | SVBUUIVLUXYFAL-WMLDXEAASA-N |
| XLogP | 4.30 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.85 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |