C27H19ClN2O — CID 4138737
2-chloro-N-[3-(3-phenylbenzo[f]quinolin-1-yl)phenyl]acetamide (PubChem CID 4138737) has the molecular formula C27H19ClN2O and a molecular weight of 422.92 g/mol. Its IUPAC name is 2-chloro-N-[3-(3-phenylbenzo[f]quinolin-1-yl)phenyl]acetamide.
| Compound Name | 2-chloro-N-[3-(3-phenylbenzo[f]quinolin-1-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 4138737 |
| Molecular Formula | C27H19ClN2O |
| Molecular Weight | 422.92 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 2-chloro-N-[3-(3-phenylbenzo[f]quinolin-1-yl)phenyl]acetamide |
| SMILES | O=C(CCl)Nc1cccc(-c2cc(-c3ccccc3)nc3ccc4ccccc4c23)c1 |
| InChI | InChI=1S/C27H19ClN2O/c28-17-26(31)29-21-11-6-10-20(15-21)23-16-25(19-8-2-1-3-9-19)30-24-14-13-18-7-4-5-12-22(18)27(23)24/h1-16H,17H2,(H,29,31) |
| InChIKey | AZMUQYNERFIFRA-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.92 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|