C25H19ClN2O — CID 67597420
2-chloro-N-[4-(2,6-diphenyl-4-pyridinyl)phenyl]acetamide (PubChem CID 67597420) has the molecular formula C25H19ClN2O and a molecular weight of 398.89 g/mol. Its IUPAC name is 2-chloro-N-[4-(2,6-diphenyl-4-pyridinyl)phenyl]acetamide.
| Compound Name | 2-chloro-N-[4-(2,6-diphenyl-4-pyridinyl)phenyl]acetamide |
|---|---|
| PubChem CID | 67597420 |
| Molecular Formula | C25H19ClN2O |
| Molecular Weight | 398.89 g/mol |
| Exact Mass | 398.12 |
| IUPAC Name | 2-chloro-N-[4-(2,6-diphenyl-4-pyridinyl)phenyl]acetamide |
| SMILES | O=C(CCl)Nc1ccc(-c2cc(-c3ccccc3)nc(-c3ccccc3)c2)cc1 |
| InChI | InChI=1S/C25H19ClN2O/c26-17-25(29)27-22-13-11-18(12-14-22)21-15-23(19-7-3-1-4-8-19)28-24(16-21)20-9-5-2-6-10-20/h1-16H,17H2,(H,27,29) |
| InChIKey | VYTDZQJYUXXDKQ-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.89 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|