About 1-pyrrolidin-1-ium-1-ylpropan-2-yl 4-bromobenzoate
1-pyrrolidin-1-ium-1-ylpropan-2-yl 4-bromobenzoate (PubChem CID 4139247) has the molecular formula C14H19BrNO2+
and a molecular weight of 313.21 g/mol. Its IUPAC name is 1-pyrrolidin-1-ium-1-ylpropan-2-yl 4-bromobenzoate.
Molecular Properties
| Compound Name | 1-pyrrolidin-1-ium-1-ylpropan-2-yl 4-bromobenzoate |
| PubChem CID | 4139247 |
| Molecular Formula | C14H19BrNO2+ |
| Molecular Weight | 313.21 g/mol |
| Exact Mass | 312.06 |
| IUPAC Name | 1-pyrrolidin-1-ium-1-ylpropan-2-yl 4-bromobenzoate |
| SMILES | CC(C[NH+]1CCCC1)OC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C14H18BrNO2/c1-11(10-16-8-2-3-9-16)18-14(17)12-4-6-13(15)7-5-12/h4-7,11H,2-3,8-10H2,1H3/p+1 |
| InChIKey | FTGYIFWMHPWALZ-UHFFFAOYSA-O |
| XLogP | 1.67 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 313.21 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-pyrrolidin-1-ium-1-ylpropan-2-yl 4-bromobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-pyrrolidin-1-ium-1-ylpropan-2-yl 4-bromobenzoate?
The IUPAC name of 1-pyrrolidin-1-ium-1-ylpropan-2-yl 4-bromobenzoate (CID 4139247) is 1-pyrrolidin-1-ium-1-ylpropan-2-yl 4-bromobenzoate.
What is the SMILES notation for 1-pyrrolidin-1-ium-1-ylpropan-2-yl 4-bromobenzoate?
The canonical SMILES for 1-pyrrolidin-1-ium-1-ylpropan-2-yl 4-bromobenzoate is CC(C[NH+]1CCCC1)OC(=O)c1ccc(Br)cc1.
What is the InChIKey of 1-pyrrolidin-1-ium-1-ylpropan-2-yl 4-bromobenzoate?
The InChIKey is FTGYIFWMHPWALZ-UHFFFAOYSA-O. The full InChI is InChI=1S/C14H18BrNO2/c1-11(10-16-8-2-3-9-16)18-14(17)12-4-6-13(15)7-5-12/h4-7,11H,2-3,8-10H2,1H3/p+1.
What are the key properties of 1-pyrrolidin-1-ium-1-ylpropan-2-yl 4-bromobenzoate?
1-pyrrolidin-1-ium-1-ylpropan-2-yl 4-bromobenzoate has a molecular weight of 313.21 g/mol, XLogP of 1.67, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-pyrrolidin-1-ium-1-ylpropan-2-yl 4-bromobenzoate is sourced from PubChem (CID 4139247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).