C21H27N3O4 — CID 41397412
3-[[2-(2,5-diethoxyanilino)acetyl]amino]-N-ethylbenzamide (PubChem CID 41397412) has the molecular formula C21H27N3O4 and a molecular weight of 385.46 g/mol. Its IUPAC name is 3-[[2-(2,5-diethoxyanilino)acetyl]amino]-N-ethylbenzamide.
| Compound Name | 3-[[2-(2,5-diethoxyanilino)acetyl]amino]-N-ethylbenzamide |
|---|---|
| PubChem CID | 41397412 |
| Molecular Formula | C21H27N3O4 |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.20 |
| IUPAC Name | 3-[[2-(2,5-diethoxyanilino)acetyl]amino]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1cccc(NC(=O)CNc2cc(OCC)ccc2OCC)c1 |
| InChI | InChI=1S/C21H27N3O4/c1-4-22-21(26)15-8-7-9-16(12-15)24-20(25)14-23-18-13-17(27-5-2)10-11-19(18)28-6-3/h7-13,23H,4-6,14H2,1-3H3,(H,22,26)(H,24,25) |
| InChIKey | NVGKBNSFTNBQEE-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |