C19H22ClN3O3 — CID 51225156
3-[[2-(4-chloro-2-methoxy-5-methylanilino)acetyl]amino]-N-ethylbenzamide (PubChem CID 51225156) has the molecular formula C19H22ClN3O3 and a molecular weight of 375.86 g/mol. Its IUPAC name is 3-[[2-(4-chloro-2-methoxy-5-methylanilino)acetyl]amino]-N-ethylbenzamide.
| Compound Name | 3-[[2-(4-chloro-2-methoxy-5-methylanilino)acetyl]amino]-N-ethylbenzamide |
|---|---|
| PubChem CID | 51225156 |
| Molecular Formula | C19H22ClN3O3 |
| Molecular Weight | 375.86 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | 3-[[2-(4-chloro-2-methoxy-5-methylanilino)acetyl]amino]-N-ethylbenzamide |
| SMILES | CCNC(=O)c1cccc(NC(=O)CNc2cc(C)c(Cl)cc2OC)c1 |
| InChI | InChI=1S/C19H22ClN3O3/c1-4-21-19(25)13-6-5-7-14(9-13)23-18(24)11-22-16-8-12(2)15(20)10-17(16)26-3/h5-10,22H,4,11H2,1-3H3,(H,21,25)(H,23,24) |
| InChIKey | GNETZCAKSASRTP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.86 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |