C22H20N4O3S2 — CID 41397880
(2R)-N-[2-(1H-benzimidazol-2-yl)phenyl]-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide (PubChem CID 41397880) has the molecular formula C22H20N4O3S2 and a molecular weight of 452.56 g/mol. Its IUPAC name is (2R)-N-[2-(1H-benzimidazol-2-yl)phenyl]-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-[2-(1H-benzimidazol-2-yl)phenyl]-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 41397880 |
| Molecular Formula | C22H20N4O3S2 |
| Molecular Weight | 452.56 g/mol |
| Exact Mass | 452.10 |
| IUPAC Name | (2R)-N-[2-(1H-benzimidazol-2-yl)phenyl]-1-thiophen-2-ylsulfonylpyrrolidine-2-carboxamide |
| SMILES | O=C(Nc1ccccc1-c1nc2ccccc2[nH]1)[C@H]1CCCN1S(=O)(=O)c1cccs1 |
| InChI | InChI=1S/C22H20N4O3S2/c27-22(19-11-5-13-26(19)31(28,29)20-12-6-14-30-20)25-16-8-2-1-7-15(16)21-23-17-9-3-4-10-18(17)24-21/h1-4,6-10,12,14,19H,5,11,13H2,(H,23,24)(H,25,27)/t19-/m1/s1 |
| InChIKey | WKKFBJWYVQNBOE-LJQANCHMSA-N |
| XLogP | 4.08 |
| TPSA | 95.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.56 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |