C25H29N3O2 — CID 41399574
3-[5-(3,4-dimethylphenyl)-1,3-oxazol-2-yl]-N-(2-methyl-4-pyrrolidin-1-ylphenyl)propanamide (PubChem CID 41399574) has the molecular formula C25H29N3O2 and a molecular weight of 403.53 g/mol. Its IUPAC name is 3-[5-(3,4-dimethylphenyl)-1,3-oxazol-2-yl]-N-(2-methyl-4-pyrrolidin-1-ylphenyl)propanamide.
| Compound Name | 3-[5-(3,4-dimethylphenyl)-1,3-oxazol-2-yl]-N-(2-methyl-4-pyrrolidin-1-ylphenyl)propanamide |
|---|---|
| PubChem CID | 41399574 |
| Molecular Formula | C25H29N3O2 |
| Molecular Weight | 403.53 g/mol |
| Exact Mass | 403.23 |
| IUPAC Name | 3-[5-(3,4-dimethylphenyl)-1,3-oxazol-2-yl]-N-(2-methyl-4-pyrrolidin-1-ylphenyl)propanamide |
| SMILES | Cc1ccc(-c2cnc(CCC(=O)Nc3ccc(N4CCCC4)cc3C)o2)cc1C |
| InChI | InChI=1S/C25H29N3O2/c1-17-6-7-20(14-18(17)2)23-16-26-25(30-23)11-10-24(29)27-22-9-8-21(15-19(22)3)28-12-4-5-13-28/h6-9,14-16H,4-5,10-13H2,1-3H3,(H,27,29) |
| InChIKey | OGNIIOPFKIKGKP-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.53 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|