C24H25N3O6 — CID 41410730
3,4-dimethoxy-N-[2-[2-[(2R)-2-naphthalen-2-yloxypropanoyl]hydrazinyl]-2-oxoethyl]benzamide (PubChem CID 41410730) has the molecular formula C24H25N3O6 and a molecular weight of 451.48 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[2-[2-[(2R)-2-naphthalen-2-yloxypropanoyl]hydrazinyl]-2-oxoethyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[2-[2-[(2R)-2-naphthalen-2-yloxypropanoyl]hydrazinyl]-2-oxoethyl]benzamide |
|---|---|
| PubChem CID | 41410730 |
| Molecular Formula | C24H25N3O6 |
| Molecular Weight | 451.48 g/mol |
| Exact Mass | 451.17 |
| IUPAC Name | 3,4-dimethoxy-N-[2-[2-[(2R)-2-naphthalen-2-yloxypropanoyl]hydrazinyl]-2-oxoethyl]benzamide |
| SMILES | COc1ccc(C(=O)NCC(=O)NNC(=O)[C@@H](C)Oc2ccc3ccccc3c2)cc1OC |
| InChI | InChI=1S/C24H25N3O6/c1-15(33-19-10-8-16-6-4-5-7-17(16)12-19)23(29)27-26-22(28)14-25-24(30)18-9-11-20(31-2)21(13-18)32-3/h4-13,15H,14H2,1-3H3,(H,25,30)(H,26,28)(H,27,29)/t15-/m1/s1 |
| InChIKey | GMPFHYQWLNWIOL-OAHLLOKOSA-N |
| XLogP | 2.20 |
| TPSA | 114.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.48 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|