C21H24FN3O7 — CID 43004148
N-[2-[2-[2-(4-fluorophenoxy)propanoyl]hydrazinyl]-2-oxoethyl]-3,4,5-trimethoxybenzamide (PubChem CID 43004148) has the molecular formula C21H24FN3O7 and a molecular weight of 449.44 g/mol. Its IUPAC name is N-[2-[2-[2-(4-fluorophenoxy)propanoyl]hydrazinyl]-2-oxoethyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[2-[2-[2-(4-fluorophenoxy)propanoyl]hydrazinyl]-2-oxoethyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 43004148 |
| Molecular Formula | C21H24FN3O7 |
| Molecular Weight | 449.44 g/mol |
| Exact Mass | 449.16 |
| IUPAC Name | N-[2-[2-[2-(4-fluorophenoxy)propanoyl]hydrazinyl]-2-oxoethyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)NCC(=O)NNC(=O)C(C)Oc2ccc(F)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C21H24FN3O7/c1-12(32-15-7-5-14(22)6-8-15)20(27)25-24-18(26)11-23-21(28)13-9-16(29-2)19(31-4)17(10-13)30-3/h5-10,12H,11H2,1-4H3,(H,23,28)(H,24,26)(H,25,27) |
| InChIKey | DDIFWJUJEXQDGU-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.44 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|