C21H18N2O5S — CID 41428666
methyl 3-[[2-[2-(phenylcarbamoyl)phenoxy]acetyl]amino]thiophene-2-carboxylate (PubChem CID 41428666) has the molecular formula C21H18N2O5S and a molecular weight of 410.45 g/mol. Its IUPAC name is methyl 3-[[2-[2-(phenylcarbamoyl)phenoxy]acetyl]amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[[2-[2-(phenylcarbamoyl)phenoxy]acetyl]amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 41428666 |
| Molecular Formula | C21H18N2O5S |
| Molecular Weight | 410.45 g/mol |
| Exact Mass | 410.09 |
| IUPAC Name | methyl 3-[[2-[2-(phenylcarbamoyl)phenoxy]acetyl]amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)COc1ccccc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C21H18N2O5S/c1-27-21(26)19-16(11-12-29-19)23-18(24)13-28-17-10-6-5-9-15(17)20(25)22-14-7-3-2-4-8-14/h2-12H,13H2,1H3,(H,22,25)(H,23,24) |
| InChIKey | RWMQDAHFGZFVAB-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.45 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |