C28H24N4O3S — CID 41432307
1-[2-(9H-fluoren-3-yl)-2-oxoethyl]sulfanyl-4-(3-methoxypropyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 41432307) has the molecular formula C28H24N4O3S and a molecular weight of 496.59 g/mol. Its IUPAC name is 1-[2-(9H-fluoren-3-yl)-2-oxoethyl]sulfanyl-4-(3-methoxypropyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
| Compound Name | 1-[2-(9H-fluoren-3-yl)-2-oxoethyl]sulfanyl-4-(3-methoxypropyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 41432307 |
| Molecular Formula | C28H24N4O3S |
| Molecular Weight | 496.59 g/mol |
| Exact Mass | 496.16 |
| IUPAC Name | 1-[2-(9H-fluoren-3-yl)-2-oxoethyl]sulfanyl-4-(3-methoxypropyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | COCCCn1c(=O)c2ccccc2n2c(SCC(=O)c3ccc4c(c3)-c3ccccc3C4)nnc12 |
| InChI | InChI=1S/C28H24N4O3S/c1-35-14-6-13-31-26(34)22-9-4-5-10-24(22)32-27(31)29-30-28(32)36-17-25(33)20-12-11-19-15-18-7-2-3-8-21(18)23(19)16-20/h2-5,7-12,16H,6,13-15,17H2,1H3 |
| InChIKey | ULVFIPDFUASVKG-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 78.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.59 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|