C20H18Cl2N4O2S — CID 39527532
1-[(2,6-dichlorophenyl)methylsulfanyl]-4-(3-methoxypropyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 39527532) has the molecular formula C20H18Cl2N4O2S and a molecular weight of 449.36 g/mol. Its IUPAC name is 1-[(2,6-dichlorophenyl)methylsulfanyl]-4-(3-methoxypropyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
| Compound Name | 1-[(2,6-dichlorophenyl)methylsulfanyl]-4-(3-methoxypropyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 39527532 |
| Molecular Formula | C20H18Cl2N4O2S |
| Molecular Weight | 449.36 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | 1-[(2,6-dichlorophenyl)methylsulfanyl]-4-(3-methoxypropyl)-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | COCCCn1c(=O)c2ccccc2n2c(SCc3c(Cl)cccc3Cl)nnc12 |
| InChI | InChI=1S/C20H18Cl2N4O2S/c1-28-11-5-10-25-18(27)13-6-2-3-9-17(13)26-19(25)23-24-20(26)29-12-14-15(21)7-4-8-16(14)22/h2-4,6-9H,5,10-12H2,1H3 |
| InChIKey | LAZVWKKERQLXFP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 61.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.36 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|