C18H20N6O2S — CID 60565027
4-(3-methoxypropyl)-1-[(1-methylimidazol-2-yl)methylsulfanyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 60565027) has the molecular formula C18H20N6O2S and a molecular weight of 384.47 g/mol. Its IUPAC name is 4-(3-methoxypropyl)-1-[(1-methylimidazol-2-yl)methylsulfanyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
| Compound Name | 4-(3-methoxypropyl)-1-[(1-methylimidazol-2-yl)methylsulfanyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 60565027 |
| Molecular Formula | C18H20N6O2S |
| Molecular Weight | 384.47 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 4-(3-methoxypropyl)-1-[(1-methylimidazol-2-yl)methylsulfanyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | COCCCn1c(=O)c2ccccc2n2c(SCc3nccn3C)nnc12 |
| InChI | InChI=1S/C18H20N6O2S/c1-22-10-8-19-15(22)12-27-18-21-20-17-23(9-5-11-26-2)16(25)13-6-3-4-7-14(13)24(17)18/h3-4,6-8,10H,5,9,11-12H2,1-2H3 |
| InChIKey | FFAJONUNZNOAQD-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 79.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.47 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|