C22H21F3N4O3S — CID 60540918
4-(3-methoxypropyl)-1-[[3-(2,2,2-trifluoroethoxy)phenyl]methylsulfanyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-one (PubChem CID 60540918) has the molecular formula C22H21F3N4O3S and a molecular weight of 478.50 g/mol. Its IUPAC name is 4-(3-methoxypropyl)-1-[[3-(2,2,2-trifluoroethoxy)phenyl]methylsulfanyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-one.
| Compound Name | 4-(3-methoxypropyl)-1-[[3-(2,2,2-trifluoroethoxy)phenyl]methylsulfanyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
|---|---|
| PubChem CID | 60540918 |
| Molecular Formula | C22H21F3N4O3S |
| Molecular Weight | 478.50 g/mol |
| Exact Mass | 478.13 |
| IUPAC Name | 4-(3-methoxypropyl)-1-[[3-(2,2,2-trifluoroethoxy)phenyl]methylsulfanyl]-[1,2,4]triazolo[4,3-a]quinazolin-5-one |
| SMILES | COCCCn1c(=O)c2ccccc2n2c(SCc3cccc(OCC(F)(F)F)c3)nnc12 |
| InChI | InChI=1S/C22H21F3N4O3S/c1-31-11-5-10-28-19(30)17-8-2-3-9-18(17)29-20(28)26-27-21(29)33-13-15-6-4-7-16(12-15)32-14-22(23,24)25/h2-4,6-9,12H,5,10-11,13-14H2,1H3 |
| InChIKey | CCDHYISQLWKNKR-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 70.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.50 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|