C21H22Cl2N2O4 — CID 41443439
1-[(2S)-2-(2,4-dichlorophenoxy)propanoyl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide (PubChem CID 41443439) has the molecular formula C21H22Cl2N2O4 and a molecular weight of 437.32 g/mol. Its IUPAC name is 1-[(2S)-2-(2,4-dichlorophenoxy)propanoyl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide.
| Compound Name | 1-[(2S)-2-(2,4-dichlorophenoxy)propanoyl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 41443439 |
| Molecular Formula | C21H22Cl2N2O4 |
| Molecular Weight | 437.32 g/mol |
| Exact Mass | 436.10 |
| IUPAC Name | 1-[(2S)-2-(2,4-dichlorophenoxy)propanoyl]-N-(2-hydroxyphenyl)piperidine-4-carboxamide |
| SMILES | C[C@H](Oc1ccc(Cl)cc1Cl)C(=O)N1CCC(C(=O)Nc2ccccc2O)CC1 |
| InChI | InChI=1S/C21H22Cl2N2O4/c1-13(29-19-7-6-15(22)12-16(19)23)21(28)25-10-8-14(9-11-25)20(27)24-17-4-2-3-5-18(17)26/h2-7,12-14,26H,8-11H2,1H3,(H,24,27)/t13-/m0/s1 |
| InChIKey | JKTKNQUGRBQVQB-ZDUSSCGKSA-N |
| XLogP | 4.34 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.32 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|