C27H26F3N3O3S — CID 4145245
N-[2-(2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole-5-carbonyl)phenyl]-3-(trifluoromethyl)benzenesulfonamide (PubChem CID 4145245) has the molecular formula C27H26F3N3O3S and a molecular weight of 529.58 g/mol. Its IUPAC name is N-[2-(2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole-5-carbonyl)phenyl]-3-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[2-(2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole-5-carbonyl)phenyl]-3-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 4145245 |
| Molecular Formula | C27H26F3N3O3S |
| Molecular Weight | 529.58 g/mol |
| Exact Mass | 529.16 |
| IUPAC Name | N-[2-(2,8-dimethyl-3,4,4a,9b-tetrahydro-1H-pyrido[4,3-b]indole-5-carbonyl)phenyl]-3-(trifluoromethyl)benzenesulfonamide |
| SMILES | Cc1ccc2c(c1)C1CN(C)CCC1N2C(=O)c1ccccc1NS(=O)(=O)c1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C27H26F3N3O3S/c1-17-10-11-24-21(14-17)22-16-32(2)13-12-25(22)33(24)26(34)20-8-3-4-9-23(20)31-37(35,36)19-7-5-6-18(15-19)27(28,29)30/h3-11,14-15,22,25,31H,12-13,16H2,1-2H3 |
| InChIKey | ABZPZZXSHCGVQI-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.58 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |