C22H29N5O2 — CID 41457161
(5R)-2-[4-(4-methoxyphenyl)piperazin-1-yl]-4-oxo-1,3-diazaspiro[5.6]dodec-1-ene-5-carbonitrile (PubChem CID 41457161) has the molecular formula C22H29N5O2 and a molecular weight of 395.51 g/mol. Its IUPAC name is (5R)-2-[4-(4-methoxyphenyl)piperazin-1-yl]-4-oxo-1,3-diazaspiro[5.6]dodec-1-ene-5-carbonitrile.
| Compound Name | (5R)-2-[4-(4-methoxyphenyl)piperazin-1-yl]-4-oxo-1,3-diazaspiro[5.6]dodec-1-ene-5-carbonitrile |
|---|---|
| PubChem CID | 41457161 |
| Molecular Formula | C22H29N5O2 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.23 |
| IUPAC Name | (5R)-2-[4-(4-methoxyphenyl)piperazin-1-yl]-4-oxo-1,3-diazaspiro[5.6]dodec-1-ene-5-carbonitrile |
| SMILES | COc1ccc(N2CCN(C3=NC4(CCCCCC4)[C@H](C#N)C(=O)N3)CC2)cc1 |
| InChI | InChI=1S/C22H29N5O2/c1-29-18-8-6-17(7-9-18)26-12-14-27(15-13-26)21-24-20(28)19(16-23)22(25-21)10-4-2-3-5-11-22/h6-9,19H,2-5,10-15H2,1H3,(H,24,25,28)/t19-/m1/s1 |
| InChIKey | LQNKOXUQAPPSST-LJQANCHMSA-N |
| XLogP | 2.54 |
| TPSA | 80.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|