C22H28N2O4 — CID 20861483
4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-3-methyl-1-oxaspiro[4.5]dec-3-en-2-one (PubChem CID 20861483) has the molecular formula C22H28N2O4 and a molecular weight of 384.48 g/mol. Its IUPAC name is 4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-3-methyl-1-oxaspiro[4.5]dec-3-en-2-one.
| Compound Name | 4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-3-methyl-1-oxaspiro[4.5]dec-3-en-2-one |
|---|---|
| PubChem CID | 20861483 |
| Molecular Formula | C22H28N2O4 |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | 4-[4-(4-methoxyphenyl)piperazine-1-carbonyl]-3-methyl-1-oxaspiro[4.5]dec-3-en-2-one |
| SMILES | COc1ccc(N2CCN(C(=O)C3=C(C)C(=O)OC34CCCCC4)CC2)cc1 |
| InChI | InChI=1S/C22H28N2O4/c1-16-19(22(28-21(16)26)10-4-3-5-11-22)20(25)24-14-12-23(13-15-24)17-6-8-18(27-2)9-7-17/h6-9H,3-5,10-15H2,1-2H3 |
| InChIKey | PHIGDNSDJGZKEH-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|