C26H36N4O5 — CID 50757831
8-acetyl-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-3-methyl-2-oxo-1-oxa-8-azaspiro[4.5]dec-3-ene-4-carboxamide (PubChem CID 50757831) has the molecular formula C26H36N4O5 and a molecular weight of 484.60 g/mol. Its IUPAC name is 8-acetyl-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-3-methyl-2-oxo-1-oxa-8-azaspiro[4.5]dec-3-ene-4-carboxamide.
| Compound Name | 8-acetyl-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-3-methyl-2-oxo-1-oxa-8-azaspiro[4.5]dec-3-ene-4-carboxamide |
|---|---|
| PubChem CID | 50757831 |
| Molecular Formula | C26H36N4O5 |
| Molecular Weight | 484.60 g/mol |
| Exact Mass | 484.27 |
| IUPAC Name | 8-acetyl-N-[3-[4-(4-methoxyphenyl)piperazin-1-yl]propyl]-3-methyl-2-oxo-1-oxa-8-azaspiro[4.5]dec-3-ene-4-carboxamide |
| SMILES | COc1ccc(N2CCN(CCCNC(=O)C3=C(C)C(=O)OC34CCN(C(C)=O)CC4)CC2)cc1 |
| InChI | InChI=1S/C26H36N4O5/c1-19-23(26(35-25(19)33)9-13-29(14-10-26)20(2)31)24(32)27-11-4-12-28-15-17-30(18-16-28)21-5-7-22(34-3)8-6-21/h5-8H,4,9-18H2,1-3H3,(H,27,32) |
| InChIKey | JSBMGUCLFKCGPU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.60 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|