C19H18F2N4O2S — CID 41462854
(6S)-6-(2,6-difluorophenyl)-4-methyl-N-(5-methyl-1,2-oxazol-3-yl)-3-prop-2-enyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxamide (PubChem CID 41462854) has the molecular formula C19H18F2N4O2S and a molecular weight of 404.44 g/mol. Its IUPAC name is (6S)-6-(2,6-difluorophenyl)-4-methyl-N-(5-methyl-1,2-oxazol-3-yl)-3-prop-2-enyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxamide.
| Compound Name | (6S)-6-(2,6-difluorophenyl)-4-methyl-N-(5-methyl-1,2-oxazol-3-yl)-3-prop-2-enyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 41462854 |
| Molecular Formula | C19H18F2N4O2S |
| Molecular Weight | 404.44 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | (6S)-6-(2,6-difluorophenyl)-4-methyl-N-(5-methyl-1,2-oxazol-3-yl)-3-prop-2-enyl-2-sulfanylidene-1,6-dihydropyrimidine-5-carboxamide |
| SMILES | C=CCN1C(=S)N[C@H](c2c(F)cccc2F)C(C(=O)Nc2cc(C)on2)=C1C |
| InChI | InChI=1S/C19H18F2N4O2S/c1-4-8-25-11(3)15(18(26)22-14-9-10(2)27-24-14)17(23-19(25)28)16-12(20)6-5-7-13(16)21/h4-7,9,17H,1,8H2,2-3H3,(H,23,28)(H,22,24,26)/t17-/m0/s1 |
| InChIKey | YKHDMSZELXOUCL-KRWDZBQOSA-N |
| XLogP | 3.59 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.44 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|