C16H12Cl3N5O2 — CID 41466930
3-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)-N'-(2,4,6-trichlorophenyl)propanehydrazide (PubChem CID 41466930) has the molecular formula C16H12Cl3N5O2 and a molecular weight of 412.66 g/mol. Its IUPAC name is 3-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)-N'-(2,4,6-trichlorophenyl)propanehydrazide.
| Compound Name | 3-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)-N'-(2,4,6-trichlorophenyl)propanehydrazide |
|---|---|
| PubChem CID | 41466930 |
| Molecular Formula | C16H12Cl3N5O2 |
| Molecular Weight | 412.66 g/mol |
| Exact Mass | 411.01 |
| IUPAC Name | 3-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)-N'-(2,4,6-trichlorophenyl)propanehydrazide |
| SMILES | O=C(CCc1nc(-c2ccncc2)no1)NNc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C16H12Cl3N5O2/c17-10-7-11(18)15(12(19)8-10)23-22-13(25)1-2-14-21-16(24-26-14)9-3-5-20-6-4-9/h3-8,23H,1-2H2,(H,22,25) |
| InChIKey | BKXISEKLSHTTPH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 92.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.66 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|