C17H14ClN5O3 — CID 41467160
4-chloro-N'-[3-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)propanoyl]benzohydrazide (PubChem CID 41467160) has the molecular formula C17H14ClN5O3 and a molecular weight of 371.78 g/mol. Its IUPAC name is 4-chloro-N'-[3-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)propanoyl]benzohydrazide.
| Compound Name | 4-chloro-N'-[3-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)propanoyl]benzohydrazide |
|---|---|
| PubChem CID | 41467160 |
| Molecular Formula | C17H14ClN5O3 |
| Molecular Weight | 371.78 g/mol |
| Exact Mass | 371.08 |
| IUPAC Name | 4-chloro-N'-[3-(3-pyridin-4-yl-1,2,4-oxadiazol-5-yl)propanoyl]benzohydrazide |
| SMILES | O=C(CCc1nc(-c2ccncc2)no1)NNC(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H14ClN5O3/c18-13-3-1-12(2-4-13)17(25)22-21-14(24)5-6-15-20-16(23-26-15)11-7-9-19-10-8-11/h1-4,7-10H,5-6H2,(H,21,24)(H,22,25) |
| InChIKey | FOWABZGSEZRNBL-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 110.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.78 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|