C20H20ClN5O3 — CID 2797349
N'-[3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]propanoyl]-4-(dimethylamino)benzohydrazide (PubChem CID 2797349) has the molecular formula C20H20ClN5O3 and a molecular weight of 413.87 g/mol. Its IUPAC name is N'-[3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]propanoyl]-4-(dimethylamino)benzohydrazide.
| Compound Name | N'-[3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]propanoyl]-4-(dimethylamino)benzohydrazide |
|---|---|
| PubChem CID | 2797349 |
| Molecular Formula | C20H20ClN5O3 |
| Molecular Weight | 413.87 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | N'-[3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]propanoyl]-4-(dimethylamino)benzohydrazide |
| SMILES | CN(C)c1ccc(C(=O)NNC(=O)CCc2nc(-c3ccc(Cl)cc3)no2)cc1 |
| InChI | InChI=1S/C20H20ClN5O3/c1-26(2)16-9-5-14(6-10-16)20(28)24-23-17(27)11-12-18-22-19(25-29-18)13-3-7-15(21)8-4-13/h3-10H,11-12H2,1-2H3,(H,23,27)(H,24,28) |
| InChIKey | BFKGRJZABCORPX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 100.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.87 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|