C20H21ClN4O2 — CID 9183218
3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N'-ethyl-N'-(4-methylphenyl)propanehydrazide (PubChem CID 9183218) has the molecular formula C20H21ClN4O2 and a molecular weight of 384.87 g/mol. Its IUPAC name is 3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N'-ethyl-N'-(4-methylphenyl)propanehydrazide.
| Compound Name | 3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N'-ethyl-N'-(4-methylphenyl)propanehydrazide |
|---|---|
| PubChem CID | 9183218 |
| Molecular Formula | C20H21ClN4O2 |
| Molecular Weight | 384.87 g/mol |
| Exact Mass | 384.14 |
| IUPAC Name | 3-[3-(4-chlorophenyl)-1,2,4-oxadiazol-5-yl]-N'-ethyl-N'-(4-methylphenyl)propanehydrazide |
| SMILES | CCN(NC(=O)CCc1nc(-c2ccc(Cl)cc2)no1)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H21ClN4O2/c1-3-25(17-10-4-14(2)5-11-17)23-18(26)12-13-19-22-20(24-27-19)15-6-8-16(21)9-7-15/h4-11H,3,12-13H2,1-2H3,(H,23,26) |
| InChIKey | VVJBIDYEWGNSMH-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.87 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|