C20H19ClN4O5 — CID 55585823
5-chloro-N'-[3-[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoyl]-2-hydroxybenzohydrazide (PubChem CID 55585823) has the molecular formula C20H19ClN4O5 and a molecular weight of 430.85 g/mol. Its IUPAC name is 5-chloro-N'-[3-[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoyl]-2-hydroxybenzohydrazide.
| Compound Name | 5-chloro-N'-[3-[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoyl]-2-hydroxybenzohydrazide |
|---|---|
| PubChem CID | 55585823 |
| Molecular Formula | C20H19ClN4O5 |
| Molecular Weight | 430.85 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | 5-chloro-N'-[3-[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoyl]-2-hydroxybenzohydrazide |
| SMILES | CCOc1ccc(-c2noc(CCC(=O)NNC(=O)c3cc(Cl)ccc3O)n2)cc1 |
| InChI | InChI=1S/C20H19ClN4O5/c1-2-29-14-6-3-12(4-7-14)19-22-18(30-25-19)10-9-17(27)23-24-20(28)15-11-13(21)5-8-16(15)26/h3-8,11,26H,2,9-10H2,1H3,(H,23,27)(H,24,28) |
| InChIKey | OOSCTODTKUTNNO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 126.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.85 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|