C24H21FN4O4S — CID 39625052
N'-[3-[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoyl]-5-(4-fluorophenyl)thiophene-2-carbohydrazide (PubChem CID 39625052) has the molecular formula C24H21FN4O4S and a molecular weight of 480.52 g/mol. Its IUPAC name is N'-[3-[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoyl]-5-(4-fluorophenyl)thiophene-2-carbohydrazide.
| Compound Name | N'-[3-[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoyl]-5-(4-fluorophenyl)thiophene-2-carbohydrazide |
|---|---|
| PubChem CID | 39625052 |
| Molecular Formula | C24H21FN4O4S |
| Molecular Weight | 480.52 g/mol |
| Exact Mass | 480.13 |
| IUPAC Name | N'-[3-[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]propanoyl]-5-(4-fluorophenyl)thiophene-2-carbohydrazide |
| SMILES | CCOc1ccc(-c2noc(CCC(=O)NNC(=O)c3ccc(-c4ccc(F)cc4)s3)n2)cc1 |
| InChI | InChI=1S/C24H21FN4O4S/c1-2-32-18-9-5-16(6-10-18)23-26-22(33-29-23)14-13-21(30)27-28-24(31)20-12-11-19(34-20)15-3-7-17(25)8-4-15/h3-12H,2,13-14H2,1H3,(H,27,30)(H,28,31) |
| InChIKey | YRMDBEMWEIVESB-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.52 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|