C17H15FN4O4 — CID 9326628
N'-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propanoyl]-2-methylfuran-3-carbohydrazide (PubChem CID 9326628) has the molecular formula C17H15FN4O4 and a molecular weight of 358.33 g/mol. Its IUPAC name is N'-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propanoyl]-2-methylfuran-3-carbohydrazide.
| Compound Name | N'-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propanoyl]-2-methylfuran-3-carbohydrazide |
|---|---|
| PubChem CID | 9326628 |
| Molecular Formula | C17H15FN4O4 |
| Molecular Weight | 358.33 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | N'-[3-[3-(4-fluorophenyl)-1,2,4-oxadiazol-5-yl]propanoyl]-2-methylfuran-3-carbohydrazide |
| SMILES | Cc1occc1C(=O)NNC(=O)CCc1nc(-c2ccc(F)cc2)no1 |
| InChI | InChI=1S/C17H15FN4O4/c1-10-13(8-9-25-10)17(24)21-20-14(23)6-7-15-19-16(22-26-15)11-2-4-12(18)5-3-11/h2-5,8-9H,6-7H2,1H3,(H,20,23)(H,21,24) |
| InChIKey | PLYHMQOTFRGMAT-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 110.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|