C23H28N4O6S — CID 30828774
N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-3-[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]propanamide (PubChem CID 30828774) has the molecular formula C23H28N4O6S and a molecular weight of 488.57 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-3-[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]propanamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-3-[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]propanamide |
|---|---|
| PubChem CID | 30828774 |
| Molecular Formula | C23H28N4O6S |
| Molecular Weight | 488.57 g/mol |
| Exact Mass | 488.17 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-hydroxyphenyl]-3-[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]propanamide |
| SMILES | CCOc1ccc(-c2noc(CCC(=O)Nc3cc(S(=O)(=O)N(CC)CC)ccc3O)n2)cc1 |
| InChI | InChI=1S/C23H28N4O6S/c1-4-27(5-2)34(30,31)18-11-12-20(28)19(15-18)24-21(29)13-14-22-25-23(26-33-22)16-7-9-17(10-8-16)32-6-3/h7-12,15,28H,4-6,13-14H2,1-3H3,(H,24,29) |
| InChIKey | BZQHQTJDESUWNO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 134.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.57 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|