C24H28N4O4 — CID 55615431
3-[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-(2-methyl-4-morpholin-4-ylphenyl)propanamide (PubChem CID 55615431) has the molecular formula C24H28N4O4 and a molecular weight of 436.51 g/mol. Its IUPAC name is 3-[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-(2-methyl-4-morpholin-4-ylphenyl)propanamide.
| Compound Name | 3-[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-(2-methyl-4-morpholin-4-ylphenyl)propanamide |
|---|---|
| PubChem CID | 55615431 |
| Molecular Formula | C24H28N4O4 |
| Molecular Weight | 436.51 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | 3-[3-(4-ethoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-(2-methyl-4-morpholin-4-ylphenyl)propanamide |
| SMILES | CCOc1ccc(-c2noc(CCC(=O)Nc3ccc(N4CCOCC4)cc3C)n2)cc1 |
| InChI | InChI=1S/C24H28N4O4/c1-3-31-20-7-4-18(5-8-20)24-26-23(32-27-24)11-10-22(29)25-21-9-6-19(16-17(21)2)28-12-14-30-15-13-28/h4-9,16H,3,10-15H2,1-2H3,(H,25,29) |
| InChIKey | QWMLYSZMIZXZSM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 89.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|