C24H29N5O3 — CID 16599968
N-[4-(4-ethylpiperazin-1-yl)phenyl]-3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanamide (PubChem CID 16599968) has the molecular formula C24H29N5O3 and a molecular weight of 435.53 g/mol. Its IUPAC name is N-[4-(4-ethylpiperazin-1-yl)phenyl]-3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanamide.
| Compound Name | N-[4-(4-ethylpiperazin-1-yl)phenyl]-3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanamide |
|---|---|
| PubChem CID | 16599968 |
| Molecular Formula | C24H29N5O3 |
| Molecular Weight | 435.53 g/mol |
| Exact Mass | 435.23 |
| IUPAC Name | N-[4-(4-ethylpiperazin-1-yl)phenyl]-3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]propanamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)CCc3nc(-c4ccc(OC)cc4)no3)cc2)CC1 |
| InChI | InChI=1S/C24H29N5O3/c1-3-28-14-16-29(17-15-28)20-8-6-19(7-9-20)25-22(30)12-13-23-26-24(27-32-23)18-4-10-21(31-2)11-5-18/h4-11H,3,12-17H2,1-2H3,(H,25,30) |
| InChIKey | QATHESBMYRZMDP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 83.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.53 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|