C24H28N4O3 — CID 16601007
3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-[4-(4-methylpiperidin-1-yl)phenyl]propanamide (PubChem CID 16601007) has the molecular formula C24H28N4O3 and a molecular weight of 420.51 g/mol. Its IUPAC name is 3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-[4-(4-methylpiperidin-1-yl)phenyl]propanamide.
| Compound Name | 3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-[4-(4-methylpiperidin-1-yl)phenyl]propanamide |
|---|---|
| PubChem CID | 16601007 |
| Molecular Formula | C24H28N4O3 |
| Molecular Weight | 420.51 g/mol |
| Exact Mass | 420.22 |
| IUPAC Name | 3-[3-(4-methoxyphenyl)-1,2,4-oxadiazol-5-yl]-N-[4-(4-methylpiperidin-1-yl)phenyl]propanamide |
| SMILES | COc1ccc(-c2noc(CCC(=O)Nc3ccc(N4CCC(C)CC4)cc3)n2)cc1 |
| InChI | InChI=1S/C24H28N4O3/c1-17-13-15-28(16-14-17)20-7-5-19(6-8-20)25-22(29)11-12-23-26-24(27-31-23)18-3-9-21(30-2)10-4-18/h3-10,17H,11-16H2,1-2H3,(H,25,29) |
| InChIKey | OAWIQOXZPLPNBJ-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 80.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.51 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|