C15H19N3O5 — CID 41475014
2-[(3R)-4-ethyl-2-oxomorpholin-3-yl]-N-(2-methyl-4-nitrophenyl)acetamide (PubChem CID 41475014) has the molecular formula C15H19N3O5 and a molecular weight of 321.33 g/mol. Its IUPAC name is 2-[(3R)-4-ethyl-2-oxomorpholin-3-yl]-N-(2-methyl-4-nitrophenyl)acetamide.
| Compound Name | 2-[(3R)-4-ethyl-2-oxomorpholin-3-yl]-N-(2-methyl-4-nitrophenyl)acetamide |
|---|---|
| PubChem CID | 41475014 |
| Molecular Formula | C15H19N3O5 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 2-[(3R)-4-ethyl-2-oxomorpholin-3-yl]-N-(2-methyl-4-nitrophenyl)acetamide |
| SMILES | CCN1CCOC(=O)[C@H]1CC(=O)Nc1ccc([N+](=O)[O-])cc1C |
| InChI | InChI=1S/C15H19N3O5/c1-3-17-6-7-23-15(20)13(17)9-14(19)16-12-5-4-11(18(21)22)8-10(12)2/h4-5,8,13H,3,6-7,9H2,1-2H3,(H,16,19)/t13-/m1/s1 |
| InChIKey | QGTRUYNTUIAKCS-CYBMUJFWSA-N |
| XLogP | 1.48 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|