C16H13BrClFN2O3 — CID 4148078
5-bromo-N-(3-chloro-4-fluorophenyl)-N-[(2-oxopyrrolidin-1-yl)methyl]furan-2-carboxamide (PubChem CID 4148078) has the molecular formula C16H13BrClFN2O3 and a molecular weight of 415.65 g/mol. Its IUPAC name is 5-bromo-N-(3-chloro-4-fluorophenyl)-N-[(2-oxopyrrolidin-1-yl)methyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-(3-chloro-4-fluorophenyl)-N-[(2-oxopyrrolidin-1-yl)methyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 4148078 |
| Molecular Formula | C16H13BrClFN2O3 |
| Molecular Weight | 415.65 g/mol |
| Exact Mass | 413.98 |
| IUPAC Name | 5-bromo-N-(3-chloro-4-fluorophenyl)-N-[(2-oxopyrrolidin-1-yl)methyl]furan-2-carboxamide |
| SMILES | O=C1CCCN1CN(C(=O)c1ccc(Br)o1)c1ccc(F)c(Cl)c1 |
| InChI | InChI=1S/C16H13BrClFN2O3/c17-14-6-5-13(24-14)16(23)21(9-20-7-1-2-15(20)22)10-3-4-12(19)11(18)8-10/h3-6,8H,1-2,7,9H2 |
| InChIKey | ZDOXLQNQZSYBOO-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 53.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.65 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |