C17H21N5O2 — CID 4150067
3-(4-methoxyphenyl)-N-[(1-methylpiperidin-4-ylidene)amino]-1H-pyrazole-5-carboxamide (PubChem CID 4150067) has the molecular formula C17H21N5O2 and a molecular weight of 327.39 g/mol. Its IUPAC name is 3-(4-methoxyphenyl)-N-[(1-methylpiperidin-4-ylidene)amino]-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(4-methoxyphenyl)-N-[(1-methylpiperidin-4-ylidene)amino]-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 4150067 |
| Molecular Formula | C17H21N5O2 |
| Molecular Weight | 327.39 g/mol |
| Exact Mass | 327.17 |
| IUPAC Name | 3-(4-methoxyphenyl)-N-[(1-methylpiperidin-4-ylidene)amino]-1H-pyrazole-5-carboxamide |
| SMILES | COc1ccc(-c2cc(C(=O)NN=C3CCN(C)CC3)[nH]n2)cc1 |
| InChI | InChI=1S/C17H21N5O2/c1-22-9-7-13(8-10-22)18-21-17(23)16-11-15(19-20-16)12-3-5-14(24-2)6-4-12/h3-6,11H,7-10H2,1-2H3,(H,19,20)(H,21,23) |
| InChIKey | CDXKIYQFBZPZRX-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|