About 2-(1H-1,3-benzodiazol-1-yl)ethan-1-amine
2-(1H-1,3-benzodiazol-1-yl)ethan-1-amine (PubChem CID 41504) has the molecular formula C9H11N3
and a molecular weight of 161.20 g/mol. Its IUPAC name is 2-(benzimidazol-1-yl)ethanamine.
Molecular Properties
| Compound Name | 2-(1H-1,3-benzodiazol-1-yl)ethan-1-amine |
| PubChem CID | 41504 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.20 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 2-(benzimidazol-1-yl)ethanamine |
| SMILES | C1=CC=C2C(=C1)N=CN2CCN |
| InChI | InChI=1S/C9H11N3/c10-5-6-12-7-11-8-3-1-2-4-9(8)12/h1-4,7H,5-6,10H2 |
| InChIKey | LXZGUUDIJIOTJB-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 43.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | 149 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.20 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(1H-1,3-benzodiazol-1-yl)ethan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1H-1,3-benzodiazol-1-yl)ethan-1-amine?
The IUPAC name of 2-(1H-1,3-benzodiazol-1-yl)ethan-1-amine (CID 41504) is 2-(benzimidazol-1-yl)ethanamine.
What is the SMILES notation for 2-(1H-1,3-benzodiazol-1-yl)ethan-1-amine?
The canonical SMILES for 2-(1H-1,3-benzodiazol-1-yl)ethan-1-amine is C1=CC=C2C(=C1)N=CN2CCN.
What is the InChIKey of 2-(1H-1,3-benzodiazol-1-yl)ethan-1-amine?
The InChIKey is LXZGUUDIJIOTJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11N3/c10-5-6-12-7-11-8-3-1-2-4-9(8)12/h1-4,7H,5-6,10H2.
What are the key properties of 2-(1H-1,3-benzodiazol-1-yl)ethan-1-amine?
2-(1H-1,3-benzodiazol-1-yl)ethan-1-amine has a molecular weight of 161.20 g/mol, XLogP of 0.40, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-1,3-benzodiazol-1-yl)ethan-1-amine is sourced from PubChem (CID 41504), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).