C13H19NO2 — CID 4153853
N-(2-methylpropyl)-1,5-dihydro-2,4-benzodioxepin-3-amine (PubChem CID 4153853) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is N-(2-methylpropyl)-1,5-dihydro-2,4-benzodioxepin-3-amine.
| Compound Name | N-(2-methylpropyl)-1,5-dihydro-2,4-benzodioxepin-3-amine |
|---|---|
| PubChem CID | 4153853 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | N-(2-methylpropyl)-1,5-dihydro-2,4-benzodioxepin-3-amine |
| SMILES | CC(C)CNC1OCc2ccccc2CO1 |
| InChI | InChI=1S/C13H19NO2/c1-10(2)7-14-13-15-8-11-5-3-4-6-12(11)9-16-13/h3-6,10,13-14H,7-9H2,1-2H3 |
| InChIKey | PVGCFHBJSPKDLC-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |