C14H22FNO3 — CID 163921700
N-[[(1S,2S)-1-(2-fluorophenyl)-1-(methoxymethoxy)propan-2-yl]oxymethyl]ethanamine (PubChem CID 163921700) has the molecular formula C14H22FNO3 and a molecular weight of 271.33 g/mol. Its IUPAC name is N-[[(1S,2S)-1-(2-fluorophenyl)-1-(methoxymethoxy)propan-2-yl]oxymethyl]ethanamine.
| Compound Name | N-[[(1S,2S)-1-(2-fluorophenyl)-1-(methoxymethoxy)propan-2-yl]oxymethyl]ethanamine |
|---|---|
| PubChem CID | 163921700 |
| Molecular Formula | C14H22FNO3 |
| Molecular Weight | 271.33 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | N-[[(1S,2S)-1-(2-fluorophenyl)-1-(methoxymethoxy)propan-2-yl]oxymethyl]ethanamine |
| SMILES | CCNCO[C@@H](C)[C@@H](OCOC)c1ccccc1F |
| InChI | InChI=1S/C14H22FNO3/c1-4-16-9-18-11(2)14(19-10-17-3)12-7-5-6-8-13(12)15/h5-8,11,14,16H,4,9-10H2,1-3H3/t11-,14+/m0/s1 |
| InChIKey | RAXYJCUBDKLPAW-SMDDNHRTSA-N |
| XLogP | 2.46 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.33 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|