C24H34N4O2S2 — CID 4155317
N,N'-bis[1-(5-ethylthiophen-2-yl)ethylideneamino]octanediamide (PubChem CID 4155317) has the molecular formula C24H34N4O2S2 and a molecular weight of 474.70 g/mol. Its IUPAC name is N,N'-bis[1-(5-ethylthiophen-2-yl)ethylideneamino]octanediamide.
| Compound Name | N,N'-bis[1-(5-ethylthiophen-2-yl)ethylideneamino]octanediamide |
|---|---|
| PubChem CID | 4155317 |
| Molecular Formula | C24H34N4O2S2 |
| Molecular Weight | 474.70 g/mol |
| Exact Mass | 474.21 |
| IUPAC Name | N,N'-bis[1-(5-ethylthiophen-2-yl)ethylideneamino]octanediamide |
| SMILES | CCc1ccc(C(C)=NNC(=O)CCCCCCC(=O)NN=C(C)c2ccc(CC)s2)s1 |
| InChI | InChI=1S/C24H34N4O2S2/c1-5-19-13-15-21(31-19)17(3)25-27-23(29)11-9-7-8-10-12-24(30)28-26-18(4)22-16-14-20(6-2)32-22/h13-16H,5-12H2,1-4H3,(H,27,29)(H,28,30) |
| InChIKey | GWPDZFFVGUMJGZ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.70 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|