C16H19N3OS — CID 4155439
N-[(1-ethylpiperidin-4-ylidene)amino]-1-benzothiophene-3-carboxamide (PubChem CID 4155439) has the molecular formula C16H19N3OS and a molecular weight of 301.41 g/mol. Its IUPAC name is N-[(1-ethylpiperidin-4-ylidene)amino]-1-benzothiophene-3-carboxamide.
| Compound Name | N-[(1-ethylpiperidin-4-ylidene)amino]-1-benzothiophene-3-carboxamide |
|---|---|
| PubChem CID | 4155439 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.41 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | N-[(1-ethylpiperidin-4-ylidene)amino]-1-benzothiophene-3-carboxamide |
| SMILES | CCN1CCC(=NNC(=O)c2csc3ccccc23)CC1 |
| InChI | InChI=1S/C16H19N3OS/c1-2-19-9-7-12(8-10-19)17-18-16(20)14-11-21-15-6-4-3-5-13(14)15/h3-6,11H,2,7-10H2,1H3,(H,18,20) |
| InChIKey | RMVMOCFIXRSDSC-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 44.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|