C9H7ClF3NO — CID 4159159
N-(4-chloro-2-methylphenyl)-2,2,2-trifluoroacetamide (PubChem CID 4159159) has the molecular formula C9H7ClF3NO and a molecular weight of 237.61 g/mol. Its IUPAC name is N-(4-chloro-2-methylphenyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(4-chloro-2-methylphenyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 4159159 |
| Molecular Formula | C9H7ClF3NO |
| Molecular Weight | 237.61 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | N-(4-chloro-2-methylphenyl)-2,2,2-trifluoroacetamide |
| SMILES | Cc1cc(Cl)ccc1NC(=O)C(F)(F)F |
| InChI | InChI=1S/C9H7ClF3NO/c1-5-4-6(10)2-3-7(5)14-8(15)9(11,12)13/h2-4H,1H3,(H,14,15) |
| InChIKey | NLFQKSORHQIDOE-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.61 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |