C18H24N2O3S2 — CID 4161397
2-ethoxyethyl 2-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylsulfanyl)butanoate (PubChem CID 4161397) has the molecular formula C18H24N2O3S2 and a molecular weight of 380.54 g/mol. Its IUPAC name is 2-ethoxyethyl 2-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylsulfanyl)butanoate.
| Compound Name | 2-ethoxyethyl 2-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylsulfanyl)butanoate |
|---|---|
| PubChem CID | 4161397 |
| Molecular Formula | C18H24N2O3S2 |
| Molecular Weight | 380.54 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 2-ethoxyethyl 2-(5,6,7,8-tetrahydro-[1]benzothiolo[2,3-d]pyrimidin-4-ylsulfanyl)butanoate |
| SMILES | CCOCCOC(=O)C(CC)Sc1ncnc2sc3c(c12)CCCC3 |
| InChI | InChI=1S/C18H24N2O3S2/c1-3-13(18(21)23-10-9-22-4-2)24-16-15-12-7-5-6-8-14(12)25-17(15)20-11-19-16/h11,13H,3-10H2,1-2H3 |
| InChIKey | WNAOAKOGKVHECO-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 61.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.54 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|